C16H23F2N3O2 — CID 120772820
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-(difluoromethoxy)phenyl]propanamide (PubChem CID 120772820) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-(difluoromethoxy)phenyl]propanamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 120772820 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-(difluoromethoxy)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1OC(F)F)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C16H23F2N3O2/c1-11(21-8-7-16(2,9-19)10-21)14(22)20-12-5-3-4-6-13(12)23-15(17)18/h3-6,11,15H,7-10,19H2,1-2H3,(H,20,22) |
| InChIKey | YGJGTVBDLWZYKH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |