C20H22N2OS3 — CID 8539488
[(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 8539488) has the molecular formula C20H22N2OS3 and a molecular weight of 402.61 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8539488 |
| Molecular Formula | C20H22N2OS3 |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@H](SC(=S)N1CCCC1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C20H22N2OS3/c1-15(25-20(24)22-13-7-8-14-22)19(23)21-17-11-5-6-12-18(17)26-16-9-3-2-4-10-16/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | BLECMJWYOQEIBW-HNNXBMFYSA-N |
| XLogP | 5.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|