C18H20N2OS2 — CID 7606742
[(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 7606742) has the molecular formula C18H20N2OS2 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606742 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@H](SC(=S)N1CCCC1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H20N2OS2/c1-13(23-18(22)20-10-4-5-11-20)17(21)19-16-9-8-14-6-2-3-7-15(14)12-16/h2-3,6-9,12-13H,4-5,10-11H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | OBVDQURZBILNQC-ZDUSSCGKSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|