C17H25FN3O2+ — CID 9442947
1-[(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9442947) has the molecular formula C17H25FN3O2+ and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9442947 |
| Molecular Formula | C17H25FN3O2+ |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C(=O)NCCc1ccc(F)cc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-12(21-10-7-14(8-11-21)16(19)22)17(23)20-9-6-13-2-4-15(18)5-3-13/h2-5,12,14H,6-11H2,1H3,(H2,19,22)(H,20,23)/p+1/t12-/m0/s1 |
| InChIKey | IROMRAQKHBLHTR-LBPRGKRZSA-O |
| XLogP | -0.35 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |