C16H23FN3O2+ — CID 9443666
1-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9443666) has the molecular formula C16H23FN3O2+ and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443666 |
| Molecular Formula | C16H23FN3O2+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(F)cc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H22FN3O2/c1-11(20-8-6-13(7-9-20)15(18)21)16(22)19-10-12-2-4-14(17)5-3-12/h2-5,11,13H,6-10H2,1H3,(H2,18,21)(H,19,22)/p+1/t11-/m0/s1 |
| InChIKey | UDHCUZPJGITIRD-NSHDSACASA-O |
| XLogP | -0.39 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |