C11H14FNO3S — CID 51946192
(2S)-N-[(4-fluorophenyl)methyl]-2-methylsulfonylpropanamide (PubChem CID 51946192) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-2-methylsulfonylpropanamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 51946192 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-2-methylsulfonylpropanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H14FNO3S/c1-8(17(2,15)16)11(14)13-7-9-3-5-10(12)6-4-9/h3-6,8H,7H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | MSXDVKBVONNNQH-QMMMGPOBSA-N |
| XLogP | 0.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |