C11H15FN2O3S — CID 30464785
N-[(4-fluorophenyl)methyl]-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 30464785) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 30464785 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H15FN2O3S/c1-14(18(2,16)17)8-11(15)13-7-9-3-5-10(12)6-4-9/h3-6H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | NIPJBCFKYMEHIT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |