C16H18FN3O5S2 — CID 28561266
2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 28561266) has the molecular formula C16H18FN3O5S2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 28561266 |
| Molecular Formula | C16H18FN3O5S2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(S(N)(=O)=O)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN3O5S2/c1-20(27(24,25)15-8-4-13(17)5-9-15)11-16(21)19-10-12-2-6-14(7-3-12)26(18,22)23/h2-9H,10-11H2,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | NDTPPOKBEWNHML-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |