C17H25FN2O3S — CID 113153055
2-[cycloheptyl(methylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 113153055) has the molecular formula C17H25FN2O3S and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[cycloheptyl(methylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[cycloheptyl(methylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 113153055 |
| Molecular Formula | C17H25FN2O3S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[cycloheptyl(methylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCc1ccc(F)cc1)C1CCCCCC1 |
| InChI | InChI=1S/C17H25FN2O3S/c1-24(22,23)20(16-6-4-2-3-5-7-16)13-17(21)19-12-14-8-10-15(18)11-9-14/h8-11,16H,2-7,12-13H2,1H3,(H,19,21) |
| InChIKey | DEKHMOLPTLGJGV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |