C14H18F2N2O3S — CID 113148994
2-[cyclopentyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)acetamide (PubChem CID 113148994) has the molecular formula C14H18F2N2O3S and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-[cyclopentyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[cyclopentyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 113148994 |
| Molecular Formula | C14H18F2N2O3S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[cyclopentyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(F)cc1F)C1CCCC1 |
| InChI | InChI=1S/C14H18F2N2O3S/c1-22(20,21)18(11-4-2-3-5-11)9-14(19)17-13-7-6-10(15)8-12(13)16/h6-8,11H,2-5,9H2,1H3,(H,17,19) |
| InChIKey | RAXURSJVVMIPCS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |