C13H16F2N2O3S — CID 113136415
3-[cyclopropyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)propanamide (PubChem CID 113136415) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-[cyclopropyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)propanamide.
| Compound Name | 3-[cyclopropyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 113136415 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-[cyclopropyl(methylsulfonyl)amino]-N-(2,4-difluorophenyl)propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)Nc1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C13H16F2N2O3S/c1-21(19,20)17(10-3-4-10)7-6-13(18)16-12-5-2-9(14)8-11(12)15/h2,5,8,10H,3-4,6-7H2,1H3,(H,16,18) |
| InChIKey | XWFVNWRGTSZTGE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |