C14H16ClF3N2O3S — CID 113136419
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-[cyclopropyl(methylsulfonyl)amino]propanamide (PubChem CID 113136419) has the molecular formula C14H16ClF3N2O3S and a molecular weight of 384.81 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-3-[cyclopropyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-[cyclopropyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113136419 |
| Molecular Formula | C14H16ClF3N2O3S |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-[cyclopropyl(methylsulfonyl)amino]propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)Nc1ccc(Cl)cc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C14H16ClF3N2O3S/c1-24(22,23)20(10-3-4-10)7-6-13(21)19-12-5-2-9(15)8-11(12)14(16,17)18/h2,5,8,10H,3-4,6-7H2,1H3,(H,19,21) |
| InChIKey | DTZWTTMKYLYLMX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |