C16H22ClF3N2O — CID 109033185
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(dipropylamino)propanamide (PubChem CID 109033185) has the molecular formula C16H22ClF3N2O and a molecular weight of 350.81 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(dipropylamino)propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(dipropylamino)propanamide |
|---|---|
| PubChem CID | 109033185 |
| Molecular Formula | C16H22ClF3N2O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(dipropylamino)propanamide |
| SMILES | CCCN(CCC)CCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H22ClF3N2O/c1-3-8-22(9-4-2)10-7-15(23)21-14-6-5-12(17)11-13(14)16(18,19)20/h5-6,11H,3-4,7-10H2,1-2H3,(H,21,23) |
| InChIKey | JYYLRPFLYCCKES-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |