C15H19ClF3N3O — CID 109017439
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(4-methylpiperazin-1-yl)propanamide (PubChem CID 109017439) has the molecular formula C15H19ClF3N3O and a molecular weight of 349.78 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 109017439 |
| Molecular Formula | C15H19ClF3N3O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CN1CCN(CCC(=O)Nc2ccc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19ClF3N3O/c1-21-6-8-22(9-7-21)5-4-14(23)20-13-3-2-11(16)10-12(13)15(17,18)19/h2-3,10H,4-9H2,1H3,(H,20,23) |
| InChIKey | QEKQKQASBQYLGP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |