C14H20FN2O+ — CID 9443017
1-[(1S)-1-(4-fluorophenyl)ethyl]piperidin-1-ium-4-carboxamide (PubChem CID 9443017) has the molecular formula C14H20FN2O+ and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[(1S)-1-(4-fluorophenyl)ethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443017 |
| Molecular Formula | C14H20FN2O+ |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](c1ccc(F)cc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C14H19FN2O/c1-10(11-2-4-13(15)5-3-11)17-8-6-12(7-9-17)14(16)18/h2-5,10,12H,6-9H2,1H3,(H2,16,18)/p+1/t10-/m0/s1 |
| InChIKey | DHEKBYHFNDZXTD-JTQLQIEISA-O |
| XLogP | 0.67 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |