C15H22FN2O3+ — CID 6926827
1-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide (PubChem CID 6926827) has the molecular formula C15H22FN2O3+ and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6926827 |
| Molecular Formula | C15H22FN2O3+ |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](C[C@H](O)COc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H21FN2O3/c16-12-1-3-14(4-2-12)21-10-13(19)9-18-7-5-11(6-8-18)15(17)20/h1-4,11,13,19H,5-10H2,(H2,17,20)/p+1/t13-/m0/s1 |
| InChIKey | APNHGIFLEPTXPM-ZDUSSCGKSA-O |
| XLogP | -0.65 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |