C17H26NO4+ — CID 7165734
methyl 4-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-ium-1-yl)propoxy]benzoate (PubChem CID 7165734) has the molecular formula C17H26NO4+ and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 4-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-ium-1-yl)propoxy]benzoate.
| Compound Name | methyl 4-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-ium-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 7165734 |
| Molecular Formula | C17H26NO4+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | methyl 4-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-ium-1-yl)propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@H](O)C[NH+]2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C17H25NO4/c1-13-7-9-18(10-8-13)11-15(19)12-22-16-5-3-14(4-6-16)17(20)21-2/h3-6,13,15,19H,7-12H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | UYQFCHQRLSEDSW-OAHLLOKOSA-O |
| XLogP | 0.53 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |