C15H24NO2+ — CID 2086460
(2R)-1-(4-methylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol (PubChem CID 2086460) has the molecular formula C15H24NO2+ and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R)-1-(4-methylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-(4-methylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 2086460 |
| Molecular Formula | C15H24NO2+ |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (2R)-1-(4-methylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol |
| SMILES | CC1CC[NH+](C[C@@H](O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23NO2/c1-13-7-9-16(10-8-13)11-14(17)12-18-15-5-3-2-4-6-15/h2-6,13-14,17H,7-12H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | NQPBQUNHSUCGLK-CQSZACIVSA-O |
| XLogP | 0.74 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |