C20H27ClN2O2+2 — CID 2247545
(2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 2247545) has the molecular formula C20H27ClN2O2+2 and a molecular weight of 362.90 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2247545 |
| Molecular Formula | C20H27ClN2O2+2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | O[C@@H](COc1ccc(Cl)cc1)C[NH+]1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25ClN2O2/c21-18-6-8-20(9-7-18)25-16-19(24)15-23-12-10-22(11-13-23)14-17-4-2-1-3-5-17/h1-9,19,24H,10-16H2/p+2/t19-/m1/s1 |
| InChIKey | ACMIQVOLDKSULT-LJQANCHMSA-P |
| XLogP | 0.06 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |