C22H30Cl2N2O3+2 — CID 9498873
(2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propan-2-ol (PubChem CID 9498873) has the molecular formula C22H30Cl2N2O3+2 and a molecular weight of 441.40 g/mol. Its IUPAC name is (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 9498873 |
| Molecular Formula | C22H30Cl2N2O3+2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propan-2-ol |
| SMILES | O[C@H](COCCOc1ccc(Cl)cc1)C[NH+]1CC[NH+](Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H28Cl2N2O3/c23-19-3-1-18(2-4-19)15-25-9-11-26(12-10-25)16-21(27)17-28-13-14-29-22-7-5-20(24)6-8-22/h1-8,21,27H,9-17H2/p+2/t21-/m0/s1 |
| InChIKey | KKCPFGYFCCFUBN-NRFANRHFSA-P |
| XLogP | 0.73 |
| TPSA | 47.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|