C19H32NO4+ — CID 7165345
(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol (PubChem CID 7165345) has the molecular formula C19H32NO4+ and a molecular weight of 338.47 g/mol. Its IUPAC name is (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 7165345 |
| Molecular Formula | C19H32NO4+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol |
| SMILES | CCc1ccc(OCCOC[C@H](O)C[NH+]2C[C@@H](C)O[C@H](C)C2)cc1 |
| InChI | InChI=1S/C19H31NO4/c1-4-17-5-7-19(8-6-17)23-10-9-22-14-18(21)13-20-11-15(2)24-16(3)12-20/h5-8,15-16,18,21H,4,9-14H2,1-3H3/p+1/t15-,16-,18-/m1/s1 |
| InChIKey | TWVPOEPZKSZYBN-JFIYKMOQSA-O |
| XLogP | 0.70 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|