C18H30ClNO3 — CID 70674125
(2R)-1-(cyclopentylamino)-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol;hydrochloride (PubChem CID 70674125) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is (2R)-1-(cyclopentylamino)-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol;hydrochloride.
| Compound Name | (2R)-1-(cyclopentylamino)-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70674125 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2R)-1-(cyclopentylamino)-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol;hydrochloride |
| SMILES | CCc1ccc(OCCOC[C@H](O)CNC2CCCC2)cc1.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-2-15-7-9-18(10-8-15)22-12-11-21-14-17(20)13-19-16-5-3-4-6-16;/h7-10,16-17,19-20H,2-6,11-14H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | HIKNJIRRHQMSNJ-UNTBIKODSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|