C19H32NO3+ — CID 7165333
(2R)-1-[2-(4-ethylphenoxy)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol (PubChem CID 7165333) has the molecular formula C19H32NO3+ and a molecular weight of 322.47 g/mol. Its IUPAC name is (2R)-1-[2-(4-ethylphenoxy)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-(4-ethylphenoxy)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7165333 |
| Molecular Formula | C19H32NO3+ |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (2R)-1-[2-(4-ethylphenoxy)ethoxy]-3-[(3S)-3-methylpiperidin-1-ium-1-yl]propan-2-ol |
| SMILES | CCc1ccc(OCCOC[C@H](O)C[NH+]2CCC[C@H](C)C2)cc1 |
| InChI | InChI=1S/C19H31NO3/c1-3-17-6-8-19(9-7-17)23-12-11-22-15-18(21)14-20-10-4-5-16(2)13-20/h6-9,16,18,21H,3-5,10-15H2,1-2H3/p+1/t16-,18+/m0/s1 |
| InChIKey | JFSVRFATAVSEMD-FUHWJXTLSA-O |
| XLogP | 1.32 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|