C21H38N2O3+2 — CID 7165481
(2R)-1-[2-(4-tert-butylphenoxy)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol (PubChem CID 7165481) has the molecular formula C21H38N2O3+2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (2R)-1-[2-(4-tert-butylphenoxy)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[2-(4-tert-butylphenoxy)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 7165481 |
| Molecular Formula | C21H38N2O3+2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (2R)-1-[2-(4-tert-butylphenoxy)ethoxy]-3-(4-ethylpiperazine-1,4-diium-1-yl)propan-2-ol |
| SMILES | CC[NH+]1CC[NH+](C[C@@H](O)COCCOc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H36N2O3/c1-5-22-10-12-23(13-11-22)16-19(24)17-25-14-15-26-20-8-6-18(7-9-20)21(2,3)4/h6-9,19,24H,5,10-17H2,1-4H3/p+2/t19-/m1/s1 |
| InChIKey | VKZRATRVJOEJLV-LJQANCHMSA-P |
| XLogP | -0.46 |
| TPSA | 47.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|