C22H30BrN2O4+ — CID 9498947
(2R)-1-[2-(4-bromophenoxy)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 9498947) has the molecular formula C22H30BrN2O4+ and a molecular weight of 466.40 g/mol. Its IUPAC name is (2R)-1-[2-(4-bromophenoxy)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-(4-bromophenoxy)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 9498947 |
| Molecular Formula | C22H30BrN2O4+ |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (2R)-1-[2-(4-bromophenoxy)ethoxy]-3-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CC[NH+](C[C@@H](O)COCCOc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H29BrN2O4/c1-27-21-8-4-19(5-9-21)25-12-10-24(11-13-25)16-20(26)17-28-14-15-29-22-6-2-18(23)3-7-22/h2-9,20,26H,10-17H2,1H3/p+1/t20-/m1/s1 |
| InChIKey | NJMDKZBARPNHDH-HXUWFJFHSA-O |
| XLogP | 1.62 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|