C18H31N2O2+ — CID 7066313
(2R)-1-butoxy-3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 7066313) has the molecular formula C18H31N2O2+ and a molecular weight of 307.46 g/mol. Its IUPAC name is (2R)-1-butoxy-3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-butoxy-3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7066313 |
| Molecular Formula | C18H31N2O2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | (2R)-1-butoxy-3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | CCCCOC[C@H](O)C[NH+]1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-3-4-13-22-15-18(21)14-19-9-11-20(12-10-19)17-7-5-16(2)6-8-17/h5-8,18,21H,3-4,9-15H2,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | KFZPNMNTHXPFJN-GOSISDBHSA-O |
| XLogP | 0.88 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|