C23H32FN2O3+ — CID 7150283
(2S)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 7150283) has the molecular formula C23H32FN2O3+ and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7150283 |
| Molecular Formula | C23H32FN2O3+ |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | Cc1cccc(C)c1OCCOC[C@@H](O)C[NH+]1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H31FN2O3/c1-18-4-3-5-19(2)23(18)29-15-14-28-17-22(27)16-25-10-12-26(13-11-25)21-8-6-20(24)7-9-21/h3-9,22,27H,10-17H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | XMTKIQRGFKPZID-QFIPXVFZSA-O |
| XLogP | 1.60 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|