C24H31F3N2O3 — CID 18865075
1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 18865075) has the molecular formula C24H31F3N2O3 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 18865075 |
| Molecular Formula | C24H31F3N2O3 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cccc(C)c1OCCOCC(O)CN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H31F3N2O3/c1-18-5-3-6-19(2)23(18)32-14-13-31-17-22(30)16-28-9-11-29(12-10-28)21-8-4-7-20(15-21)24(25,26)27/h3-8,15,22,30H,9-14,16-17H2,1-2H3 |
| InChIKey | BOFWIGMMBMRXQK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|