C23H33F3N2O2 — CID 98768954
(2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 98768954) has the molecular formula C23H33F3N2O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 98768954 |
| Molecular Formula | C23H33F3N2O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | O[C@@H](COCC[C@H]1C[C@H]2CC[C@H]1C2)CN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H33F3N2O2/c24-23(25,26)20-2-1-3-21(14-20)28-9-7-27(8-10-28)15-22(29)16-30-11-6-19-13-17-4-5-18(19)12-17/h1-3,14,17-19,22,29H,4-13,15-16H2/t17-,18-,19-,22+/m0/s1 |
| InChIKey | YCHSJZUFSWFLQA-ZVVDCOBXSA-N |
| XLogP | 4.03 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|