C22H33FN2O2 — CID 98734909
(2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 98734909) has the molecular formula C22H33FN2O2 and a molecular weight of 376.52 g/mol. Its IUPAC name is (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 98734909 |
| Molecular Formula | C22H33FN2O2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (2R)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | O[C@@H](COCC[C@H]1C[C@H]2CC[C@H]1C2)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H33FN2O2/c23-21-3-1-2-4-22(21)25-10-8-24(9-11-25)15-20(26)16-27-12-7-19-14-17-5-6-18(19)13-17/h1-4,17-20,26H,5-16H2/t17-,18-,19-,20+/m0/s1 |
| InChIKey | APZLVUPZQBGPMW-LWYYNNOASA-N |
| XLogP | 3.15 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|