C22H34N2O2 — CID 124853742
(2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 124853742) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 124853742 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | O[C@H](COCC[C@H]1C[C@H]2CC[C@H]1C2)CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c25-22(17-26-13-8-20-15-18-6-7-19(20)14-18)16-23-9-11-24(12-10-23)21-4-2-1-3-5-21/h1-5,18-20,22,25H,6-17H2/t18-,19-,20-,22-/m0/s1 |
| InChIKey | UVDCFKBWGHQJTL-XWUOBKMESA-N |
| XLogP | 3.01 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|