C29H40N2O2 — CID 98310094
(2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol (PubChem CID 98310094) has the molecular formula C29H40N2O2 and a molecular weight of 448.65 g/mol. Its IUPAC name is (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol.
| Compound Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 98310094 |
| Molecular Formula | C29H40N2O2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol |
| SMILES | O[C@H](COCC[C@@H]1C[C@@H]2CC[C@@H]1C2)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H40N2O2/c32-28(22-33-18-13-27-20-23-11-12-26(27)19-23)21-30-14-16-31(17-15-30)29(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-10,23,26-29,32H,11-22H2/t23-,26-,27-,28+/m1/s1 |
| InChIKey | XGYSHEBVTIRMJH-MUUFRUSVSA-N |
| XLogP | 4.60 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|