C18H34N2O3 — CID 124853517
(2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol (PubChem CID 124853517) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 124853517 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (2S)-1-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
| SMILES | OCCN1CCN(C[C@H](O)COCC[C@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C18H34N2O3/c21-9-8-19-4-6-20(7-5-19)13-18(22)14-23-10-3-17-12-15-1-2-16(17)11-15/h15-18,21-22H,1-14H2/t15-,16-,17-,18-/m0/s1 |
| InChIKey | QUSNKRWGCRABRJ-XSLAGTTESA-N |
| XLogP | 0.80 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|