C18H33NO3 — CID 98588160
(2S)-1-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol (PubChem CID 98588160) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (2S)-1-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 98588160 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | (2S)-1-[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
| SMILES | C[C@H]1CN(C[C@H](O)COCC[C@@H]2C[C@@H]3CC[C@@H]2C3)C[C@H](C)O1 |
| InChI | InChI=1S/C18H33NO3/c1-13-9-19(10-14(2)22-13)11-18(20)12-21-6-5-17-8-15-3-4-16(17)7-15/h13-18,20H,3-12H2,1-2H3/t13-,14-,15+,16+,17+,18-/m0/s1 |
| InChIKey | BTWIPZIBMYFMPI-MNWMBMHPSA-N |
| XLogP | 2.30 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|