C15H33NO6Si — CID 90015661
1-(2,6-dimethylmorpholin-4-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol (PubChem CID 90015661) has the molecular formula C15H33NO6Si and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 90015661 |
| Molecular Formula | C15H33NO6Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol |
| SMILES | CO[Si](CCCOCC(O)CN1CC(C)OC(C)C1)(OC)OC |
| InChI | InChI=1S/C15H33NO6Si/c1-13-9-16(10-14(2)22-13)11-15(17)12-21-7-6-8-23(18-3,19-4)20-5/h13-15,17H,6-12H2,1-5H3 |
| InChIKey | QVTOBIXXHDBTEO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|