C14H34O7Si — CID 90896720
1-methoxypropane;1-methoxy-3-(3-trimethoxysilylpropoxy)propan-2-ol (PubChem CID 90896720) has the molecular formula C14H34O7Si and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-methoxypropane;1-methoxy-3-(3-trimethoxysilylpropoxy)propan-2-ol.
| Compound Name | 1-methoxypropane;1-methoxy-3-(3-trimethoxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 90896720 |
| Molecular Formula | C14H34O7Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-methoxypropane;1-methoxy-3-(3-trimethoxysilylpropoxy)propan-2-ol |
| SMILES | CCCOC.COCC(O)COCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H24O6Si.C4H10O/c1-12-8-10(11)9-16-6-5-7-17(13-2,14-3)15-4;1-3-4-5-2/h10-11H,5-9H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | IUNOESDSZDSUHI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|