C19H31NO4 — CID 18590100
1-(2,6-dimethylmorpholin-4-yl)-3-[2-(3,4-dimethylphenoxy)ethoxy]propan-2-ol (PubChem CID 18590100) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-3-[2-(3,4-dimethylphenoxy)ethoxy]propan-2-ol.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-3-[2-(3,4-dimethylphenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 18590100 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-3-[2-(3,4-dimethylphenoxy)ethoxy]propan-2-ol |
| SMILES | Cc1ccc(OCCOCC(O)CN2CC(C)OC(C)C2)cc1C |
| InChI | InChI=1S/C19H31NO4/c1-14-5-6-19(9-15(14)2)23-8-7-22-13-18(21)12-20-10-16(3)24-17(4)11-20/h5-6,9,16-18,21H,7-8,10-13H2,1-4H3 |
| InChIKey | WSHQOUXSXXZRJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|