C18H30N2O3 — CID 7424688
(2R)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 7424688) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2R)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 7424688 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2R)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | Cc1ccc(OCCOC[C@H](O)CN2CCN(C)CC2)cc1C |
| InChI | InChI=1S/C18H30N2O3/c1-15-4-5-18(12-16(15)2)23-11-10-22-14-17(21)13-20-8-6-19(3)7-9-20/h4-5,12,17,21H,6-11,13-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | AGJJWBPHKJIARS-QGZVFWFLSA-N |
| XLogP | 1.31 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|