C20H33NO3 — CID 7424644
(2S)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 7424644) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is (2S)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7424644 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (2S)-1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(OCCOC[C@@H](O)CN2C[C@@H](C)C[C@H](C)C2)cc1C |
| InChI | InChI=1S/C20H33NO3/c1-15-9-16(2)12-21(11-15)13-19(22)14-23-7-8-24-20-6-5-17(3)18(4)10-20/h5-6,10,15-16,19,22H,7-9,11-14H2,1-4H3/t15-,16-,19-/m0/s1 |
| InChIKey | YRICGBORXDOMKB-BXWFABGCSA-N |
| XLogP | 3.04 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|