C18H29NO3 — CID 56724974
1-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenoxy)butan-2-ol (PubChem CID 56724974) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenoxy)butan-2-ol.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 56724974 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenoxy)butan-2-ol |
| SMILES | Cc1ccc(OCCC(O)CN2CC(C)OC(C)C2)cc1C |
| InChI | InChI=1S/C18H29NO3/c1-13-5-6-18(9-14(13)2)21-8-7-17(20)12-19-10-15(3)22-16(4)11-19/h5-6,9,15-17,20H,7-8,10-12H2,1-4H3 |
| InChIKey | XLVAXEJEYWVORY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |