C17H26ClNO4 — CID 7165338
(2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-2-ol (PubChem CID 7165338) has the molecular formula C17H26ClNO4 and a molecular weight of 343.85 g/mol. Its IUPAC name is (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 7165338 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
| SMILES | C[C@@H]1CN(C[C@H](O)COCCOc2ccc(Cl)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H26ClNO4/c1-13-9-19(10-14(2)23-13)11-16(20)12-21-7-8-22-17-5-3-15(18)4-6-17/h3-6,13-14,16,20H,7-12H2,1-2H3/t13-,14+,16-/m0/s1 |
| InChIKey | BZTYRRSXABACSU-LZWOXQAQSA-N |
| XLogP | 2.21 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|