C18H29NO2 — CID 2184552
(2R,6R)-4-[4-(3,4-dimethylphenoxy)butyl]-2,6-dimethylmorpholine (PubChem CID 2184552) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2R,6R)-4-[4-(3,4-dimethylphenoxy)butyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-[4-(3,4-dimethylphenoxy)butyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2184552 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2R,6R)-4-[4-(3,4-dimethylphenoxy)butyl]-2,6-dimethylmorpholine |
| SMILES | Cc1ccc(OCCCCN2C[C@@H](C)O[C@H](C)C2)cc1C |
| InChI | InChI=1S/C18H29NO2/c1-14-7-8-18(11-15(14)2)20-10-6-5-9-19-12-16(3)21-17(4)13-19/h7-8,11,16-17H,5-6,9-10,12-13H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | MPQYZXUZHVKOLR-IAGOWNOFSA-N |
| XLogP | 3.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|