C16H24INO2 — CID 2182517
(2S,6S)-4-[4-(4-iodophenoxy)butyl]-2,6-dimethylmorpholine (PubChem CID 2182517) has the molecular formula C16H24INO2 and a molecular weight of 389.28 g/mol. Its IUPAC name is (2S,6S)-4-[4-(4-iodophenoxy)butyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-[4-(4-iodophenoxy)butyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2182517 |
| Molecular Formula | C16H24INO2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2S,6S)-4-[4-(4-iodophenoxy)butyl]-2,6-dimethylmorpholine |
| SMILES | C[C@H]1CN(CCCCOc2ccc(I)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H24INO2/c1-13-11-18(12-14(2)20-13)9-3-4-10-19-16-7-5-15(17)6-8-16/h5-8,13-14H,3-4,9-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | RLYSFUFLEUQWFN-KBPBESRZSA-N |
| XLogP | 3.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|