C14H20FNO2 — CID 888238
(2R,6R)-4-[2-(4-fluorophenoxy)ethyl]-2,6-dimethylmorpholine (PubChem CID 888238) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is (2R,6R)-4-[2-(4-fluorophenoxy)ethyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-[2-(4-fluorophenoxy)ethyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 888238 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2R,6R)-4-[2-(4-fluorophenoxy)ethyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(CCOc2ccc(F)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H20FNO2/c1-11-9-16(10-12(2)18-11)7-8-17-14-5-3-13(15)4-6-14/h3-6,11-12H,7-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | BQHDAFJCLBCPRU-VXGBXAGGSA-N |
| XLogP | 2.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |