C16H22N2O2 — CID 7380226
4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]benzonitrile (PubChem CID 7380226) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 7380226 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]benzonitrile |
| SMILES | C[C@@H]1CN(CCCOc2ccc(C#N)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H22N2O2/c1-13-11-18(12-14(2)20-13)8-3-9-19-16-6-4-15(10-17)5-7-16/h4-7,13-14H,3,8-9,11-12H2,1-2H3/t13-,14+ |
| InChIKey | IRCDFVNMJFMFPR-OKILXGFUSA-N |
| XLogP | 2.44 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|