C17H25ClN2O3 — CID 2993844
4-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzonitrile;hydrochloride (PubChem CID 2993844) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 4-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzonitrile;hydrochloride.
| Compound Name | 4-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 2993844 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzonitrile;hydrochloride |
| SMILES | CC1CN(CCOCCOc2ccc(C#N)cc2)CC(C)O1.Cl |
| InChI | InChI=1S/C17H24N2O3.ClH/c1-14-12-19(13-15(2)22-14)7-8-20-9-10-21-17-5-3-16(11-18)4-6-17;/h3-6,14-15H,7-10,12-13H2,1-2H3;1H |
| InChIKey | IRWRDILYTUUDGG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|