C18H27NO5 — CID 7412586
methyl 4-[2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzoate (PubChem CID 7412586) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 4-[2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 7412586 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methyl 4-[2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOCCN2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C18H27NO5/c1-14-12-19(13-15(2)24-14)8-9-22-10-11-23-17-6-4-16(5-7-17)18(20)21-3/h4-7,14-15H,8-13H2,1-3H3/t14-,15+ |
| InChIKey | QQSKVCYJGVEKJN-GASCZTMLSA-N |
| XLogP | 1.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|