C20H31NO7 — CID 2934633
4-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine;oxalic acid (PubChem CID 2934633) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine;oxalic acid.
| Compound Name | 4-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 2934633 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 4-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine;oxalic acid |
| SMILES | CCc1cccc(OCCOCCN2CC(C)OC(C)C2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H29NO3.C2H2O4/c1-4-17-6-5-7-18(12-17)21-11-10-20-9-8-19-13-15(2)22-16(3)14-19;3-1(4)2(5)6/h5-7,12,15-16H,4,8-11,13-14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UMQSDPOYNDBPPH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|