C25H33NO7 — CID 2935913
3,5-dimethyl-1-[2-[2-(3-phenoxyphenoxy)ethoxy]ethyl]piperidine;oxalic acid (PubChem CID 2935913) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 3,5-dimethyl-1-[2-[2-(3-phenoxyphenoxy)ethoxy]ethyl]piperidine;oxalic acid.
| Compound Name | 3,5-dimethyl-1-[2-[2-(3-phenoxyphenoxy)ethoxy]ethyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 2935913 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3,5-dimethyl-1-[2-[2-(3-phenoxyphenoxy)ethoxy]ethyl]piperidine;oxalic acid |
| SMILES | CC1CC(C)CN(CCOCCOc2cccc(Oc3ccccc3)c2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H31NO3.C2H2O4/c1-19-15-20(2)18-24(17-19)11-12-25-13-14-26-22-9-6-10-23(16-22)27-21-7-4-3-5-8-21;3-1(4)2(5)6/h3-10,16,19-20H,11-15,17-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VCHWZXQAFKNAQT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|