C20H25NO3 — CID 887587
(2S,6S)-2,6-dimethyl-4-[2-(3-phenoxyphenoxy)ethyl]morpholine (PubChem CID 887587) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-[2-(3-phenoxyphenoxy)ethyl]morpholine.
| Compound Name | (2S,6S)-2,6-dimethyl-4-[2-(3-phenoxyphenoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 887587 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-[2-(3-phenoxyphenoxy)ethyl]morpholine |
| SMILES | C[C@H]1CN(CCOc2cccc(Oc3ccccc3)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H25NO3/c1-16-14-21(15-17(2)23-16)11-12-22-19-9-6-10-20(13-19)24-18-7-4-3-5-8-18/h3-10,13,16-17H,11-12,14-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | AUKVZJDZUISANR-IRXDYDNUSA-N |
| XLogP | 3.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |